C12H14N2OS — CID 103013437
4-[2-(2-methylpyrazol-3-yl)ethylsulfanyl]phenol (PubChem CID 103013437) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 4-[2-(2-methylpyrazol-3-yl)ethylsulfanyl]phenol.
| Compound Name | 4-[2-(2-methylpyrazol-3-yl)ethylsulfanyl]phenol |
|---|---|
| PubChem CID | 103013437 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 4-[2-(2-methylpyrazol-3-yl)ethylsulfanyl]phenol |
| SMILES | Cn1nccc1CCSc1ccc(O)cc1 |
| InChI | InChI=1S/C12H14N2OS/c1-14-10(6-8-13-14)7-9-16-12-4-2-11(15)3-5-12/h2-6,8,15H,7,9H2,1H3 |
| InChIKey | AHISLUGAFMFCOM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |