C10H17N3S — CID 103004598
4-[2-(2-methylpyrazol-3-yl)ethyl]thiolan-3-amine (PubChem CID 103004598) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is 4-[2-(2-methylpyrazol-3-yl)ethyl]thiolan-3-amine.
| Compound Name | 4-[2-(2-methylpyrazol-3-yl)ethyl]thiolan-3-amine |
|---|---|
| PubChem CID | 103004598 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 4-[2-(2-methylpyrazol-3-yl)ethyl]thiolan-3-amine |
| SMILES | Cn1nccc1CCC1CSCC1N |
| InChI | InChI=1S/C10H17N3S/c1-13-9(4-5-12-13)3-2-8-6-14-7-10(8)11/h4-5,8,10H,2-3,6-7,11H2,1H3 |
| InChIKey | OTVJGCUZXPKNMZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |