C14H24N4 — CID 103005279
4-ethyl-5-[2-(2-methylpyrazol-3-yl)ethyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 103005279) has the molecular formula C14H24N4 and a molecular weight of 248.37 g/mol. Its IUPAC name is 4-ethyl-5-[2-(2-methylpyrazol-3-yl)ethyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 4-ethyl-5-[2-(2-methylpyrazol-3-yl)ethyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 103005279 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 4-ethyl-5-[2-(2-methylpyrazol-3-yl)ethyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | CCC1C2CNCC2CN1CCc1ccnn1C |
| InChI | InChI=1S/C14H24N4/c1-3-14-13-9-15-8-11(13)10-18(14)7-5-12-4-6-16-17(12)2/h4,6,11,13-15H,3,5,7-10H2,1-2H3 |
| InChIKey | AYLMJQKBTLFAPH-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |