C10H16ClN3O — CID 103005493
3-chloro-2-methyl-N-[2-(2-methylpyrazol-3-yl)ethyl]propanamide (PubChem CID 103005493) has the molecular formula C10H16ClN3O and a molecular weight of 229.71 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-[2-(2-methylpyrazol-3-yl)ethyl]propanamide.
| Compound Name | 3-chloro-2-methyl-N-[2-(2-methylpyrazol-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 103005493 |
| Molecular Formula | C10H16ClN3O |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 3-chloro-2-methyl-N-[2-(2-methylpyrazol-3-yl)ethyl]propanamide |
| SMILES | CC(CCl)C(=O)NCCc1ccnn1C |
| InChI | InChI=1S/C10H16ClN3O/c1-8(7-11)10(15)12-5-3-9-4-6-13-14(9)2/h4,6,8H,3,5,7H2,1-2H3,(H,12,15) |
| InChIKey | WYSYKJHTMGGEAZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|