C10H18N4O — CID 104693386
1-[2-(2-methylpyrazol-3-yl)ethyl]-3-propan-2-ylurea (PubChem CID 104693386) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-[2-(2-methylpyrazol-3-yl)ethyl]-3-propan-2-ylurea.
| Compound Name | 1-[2-(2-methylpyrazol-3-yl)ethyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 104693386 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 1-[2-(2-methylpyrazol-3-yl)ethyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NCCc1ccnn1C |
| InChI | InChI=1S/C10H18N4O/c1-8(2)13-10(15)11-6-4-9-5-7-12-14(9)3/h5,7-8H,4,6H2,1-3H3,(H2,11,13,15) |
| InChIKey | BBBQAMBWDZQEAI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |