C12H19N5O4 — CID 107831193
(2R)-5-amino-2-[2-(2-methylpyrazol-3-yl)ethylcarbamoylamino]-5-oxopentanoic acid (PubChem CID 107831193) has the molecular formula C12H19N5O4 and a molecular weight of 297.31 g/mol. Its IUPAC name is (2R)-5-amino-2-[2-(2-methylpyrazol-3-yl)ethylcarbamoylamino]-5-oxopentanoic acid.
| Compound Name | (2R)-5-amino-2-[2-(2-methylpyrazol-3-yl)ethylcarbamoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107831193 |
| Molecular Formula | C12H19N5O4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (2R)-5-amino-2-[2-(2-methylpyrazol-3-yl)ethylcarbamoylamino]-5-oxopentanoic acid |
| SMILES | Cn1nccc1CCNC(=O)N[C@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C12H19N5O4/c1-17-8(5-7-15-17)4-6-14-12(21)16-9(11(19)20)2-3-10(13)18/h5,7,9H,2-4,6H2,1H3,(H2,13,18)(H,19,20)(H2,14,16,21)/t9-/m1/s1 |
| InChIKey | WLTMGXTXMVPLIP-SECBINFHSA-N |
| XLogP | -1.02 |
| TPSA | 139.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |