C11H13ClN2OS — CID 103006427
1-(4-chlorothiophen-2-yl)-3-(2-methylpyrazol-3-yl)propan-1-ol (PubChem CID 103006427) has the molecular formula C11H13ClN2OS and a molecular weight of 256.76 g/mol. Its IUPAC name is 1-(4-chlorothiophen-2-yl)-3-(2-methylpyrazol-3-yl)propan-1-ol.
| Compound Name | 1-(4-chlorothiophen-2-yl)-3-(2-methylpyrazol-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 103006427 |
| Molecular Formula | C11H13ClN2OS |
| Molecular Weight | 256.76 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 1-(4-chlorothiophen-2-yl)-3-(2-methylpyrazol-3-yl)propan-1-ol |
| SMILES | Cn1nccc1CCC(O)c1cc(Cl)cs1 |
| InChI | InChI=1S/C11H13ClN2OS/c1-14-9(4-5-13-14)2-3-10(15)11-6-8(12)7-16-11/h4-7,10,15H,2-3H2,1H3 |
| InChIKey | AZQGTWLKPUMXMI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.76 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |