C12H12ClFN2OS — CID 114644228
1-(4-chloro-1-methylpyrazol-5-yl)-2-(3-fluorophenyl)sulfanylethanol (PubChem CID 114644228) has the molecular formula C12H12ClFN2OS and a molecular weight of 286.76 g/mol. Its IUPAC name is 1-(4-chloro-1-methylpyrazol-5-yl)-2-(3-fluorophenyl)sulfanylethanol.
| Compound Name | 1-(4-chloro-1-methylpyrazol-5-yl)-2-(3-fluorophenyl)sulfanylethanol |
|---|---|
| PubChem CID | 114644228 |
| Molecular Formula | C12H12ClFN2OS |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 1-(4-chloro-1-methylpyrazol-5-yl)-2-(3-fluorophenyl)sulfanylethanol |
| SMILES | Cn1ncc(Cl)c1C(O)CSc1cccc(F)c1 |
| InChI | InChI=1S/C12H12ClFN2OS/c1-16-12(10(13)6-15-16)11(17)7-18-9-4-2-3-8(14)5-9/h2-6,11,17H,7H2,1H3 |
| InChIKey | PMPUCEKZVWIUSZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |