C31H56O5 — CID 10301058
methyl (2E,6E,10E)-9,13-dihydroxy-5-methoxy-2,4,6,8,10,12,14,16,18-nonamethylicosa-2,6,10-trienoate (PubChem CID 10301058) has the molecular formula C31H56O5 and a molecular weight of 508.78 g/mol. Its IUPAC name is methyl (2E,6E,10E)-9,13-dihydroxy-5-methoxy-2,4,6,8,10,12,14,16,18-nonamethylicosa-2,6,10-trienoate.
| Compound Name | methyl (2E,6E,10E)-9,13-dihydroxy-5-methoxy-2,4,6,8,10,12,14,16,18-nonamethylicosa-2,6,10-trienoate |
|---|---|
| PubChem CID | 10301058 |
| Molecular Formula | C31H56O5 |
| Molecular Weight | 508.78 g/mol |
| Exact Mass | 508.41 |
| IUPAC Name | methyl (2E,6E,10E)-9,13-dihydroxy-5-methoxy-2,4,6,8,10,12,14,16,18-nonamethylicosa-2,6,10-trienoate |
| SMILES | CCC(C)CC(C)CC(C)C(O)C(C)/C=C(\C)C(O)C(C)/C=C(\C)C(OC)C(C)/C=C(\C)C(=O)OC |
| InChI | InChI=1S/C31H56O5/c1-13-19(2)14-20(3)15-21(4)28(32)22(5)16-23(6)29(33)24(7)17-25(8)30(35-11)26(9)18-27(10)31(34)36-12/h16-22,24,26,28-30,32-33H,13-15H2,1-12H3/b23-16+,25-17+,27-18+ |
| InChIKey | ULKGLGIFPRDHIG-SHIDMVPSSA-N |
| XLogP | 6.74 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.78 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|