C10H16N4O — CID 103012757
1-[2-(2-methylpyrazol-3-yl)ethyl]-1,3-diazinan-2-one (PubChem CID 103012757) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-[2-(2-methylpyrazol-3-yl)ethyl]-1,3-diazinan-2-one.
| Compound Name | 1-[2-(2-methylpyrazol-3-yl)ethyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 103012757 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 1-[2-(2-methylpyrazol-3-yl)ethyl]-1,3-diazinan-2-one |
| SMILES | Cn1nccc1CCN1CCCNC1=O |
| InChI | InChI=1S/C10H16N4O/c1-13-9(3-6-12-13)4-8-14-7-2-5-11-10(14)15/h3,6H,2,4-5,7-8H2,1H3,(H,11,15) |
| InChIKey | XSYGCEHPXBHPPC-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |