C26H30F6N2O3 — CID 10302076
5-[4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]piperazin-1-yl]pentanoic acid (PubChem CID 10302076) has the molecular formula C26H30F6N2O3 and a molecular weight of 532.53 g/mol. Its IUPAC name is 5-[4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]piperazin-1-yl]pentanoic acid.
| Compound Name | 5-[4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]piperazin-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 10302076 |
| Molecular Formula | C26H30F6N2O3 |
| Molecular Weight | 532.53 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 5-[4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]piperazin-1-yl]pentanoic acid |
| SMILES | O=C(O)CCCCN1CCN(C(COCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H30F6N2O3/c27-25(28,29)21-14-19(15-22(16-21)26(30,31)32)17-37-18-23(20-6-2-1-3-7-20)34-12-10-33(11-13-34)9-5-4-8-24(35)36/h1-3,6-7,14-16,23H,4-5,8-13,17-18H2,(H,35,36) |
| InChIKey | SVVJEDRBKOBRPP-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.53 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|