C14H30N2O2 — CID 103025520
[3-methoxy-3-methyl-1-(2,2,5,5-tetramethyloxolan-3-yl)butyl]hydrazine (PubChem CID 103025520) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is [3-methoxy-3-methyl-1-(2,2,5,5-tetramethyloxolan-3-yl)butyl]hydrazine.
| Compound Name | [3-methoxy-3-methyl-1-(2,2,5,5-tetramethyloxolan-3-yl)butyl]hydrazine |
|---|---|
| PubChem CID | 103025520 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | [3-methoxy-3-methyl-1-(2,2,5,5-tetramethyloxolan-3-yl)butyl]hydrazine |
| SMILES | COC(C)(C)CC(NN)C1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C14H30N2O2/c1-12(2,17-7)9-11(16-15)10-8-13(3,4)18-14(10,5)6/h10-11,16H,8-9,15H2,1-7H3 |
| InChIKey | SSYSMHZDMCOFNI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|