C13H25F3N2O2 — CID 103151528
[1-(2,2,5,5-tetramethyloxolan-3-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine (PubChem CID 103151528) has the molecular formula C13H25F3N2O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is [1-(2,2,5,5-tetramethyloxolan-3-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine.
| Compound Name | [1-(2,2,5,5-tetramethyloxolan-3-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine |
|---|---|
| PubChem CID | 103151528 |
| Molecular Formula | C13H25F3N2O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | [1-(2,2,5,5-tetramethyloxolan-3-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine |
| SMILES | CC1(C)CC(C(CCOCC(F)(F)F)NN)C(C)(C)O1 |
| InChI | InChI=1S/C13H25F3N2O2/c1-11(2)7-9(12(3,4)20-11)10(18-17)5-6-19-8-13(14,15)16/h9-10,18H,5-8,17H2,1-4H3 |
| InChIKey | GDBBLEXJVZLPCO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|