C13H22N6 — CID 103025805
[1-(3-ethyl-1-methylpyrazol-5-yl)-3-(1-methylpyrazol-4-yl)propyl]hydrazine (PubChem CID 103025805) has the molecular formula C13H22N6 and a molecular weight of 262.36 g/mol. Its IUPAC name is [1-(3-ethyl-1-methylpyrazol-5-yl)-3-(1-methylpyrazol-4-yl)propyl]hydrazine.
| Compound Name | [1-(3-ethyl-1-methylpyrazol-5-yl)-3-(1-methylpyrazol-4-yl)propyl]hydrazine |
|---|---|
| PubChem CID | 103025805 |
| Molecular Formula | C13H22N6 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | [1-(3-ethyl-1-methylpyrazol-5-yl)-3-(1-methylpyrazol-4-yl)propyl]hydrazine |
| SMILES | CCc1cc(C(CCc2cnn(C)c2)NN)n(C)n1 |
| InChI | InChI=1S/C13H22N6/c1-4-11-7-13(19(3)17-11)12(16-14)6-5-10-8-15-18(2)9-10/h7-9,12,16H,4-6,14H2,1-3H3 |
| InChIKey | DQYCEFGHSPWYOT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|