C14H18F2N4 — CID 103026693
[1-(3,5-difluorophenyl)-4-(2-methylpyrazol-3-yl)butan-2-yl]hydrazine (PubChem CID 103026693) has the molecular formula C14H18F2N4 and a molecular weight of 280.32 g/mol. Its IUPAC name is [1-(3,5-difluorophenyl)-4-(2-methylpyrazol-3-yl)butan-2-yl]hydrazine.
| Compound Name | [1-(3,5-difluorophenyl)-4-(2-methylpyrazol-3-yl)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103026693 |
| Molecular Formula | C14H18F2N4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | [1-(3,5-difluorophenyl)-4-(2-methylpyrazol-3-yl)butan-2-yl]hydrazine |
| SMILES | Cn1nccc1CCC(Cc1cc(F)cc(F)c1)NN |
| InChI | InChI=1S/C14H18F2N4/c1-20-14(4-5-18-20)3-2-13(19-17)8-10-6-11(15)9-12(16)7-10/h4-7,9,13,19H,2-3,8,17H2,1H3 |
| InChIKey | RNCPUOSZOVRKMT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|