C36H41N3O2 — CID 10302679
N-[1-[(4-hydroxyphenyl)methyl]piperidin-4-yl]-4-pentyl-N-[(4-pyridin-3-ylphenyl)methyl]benzamide (PubChem CID 10302679) has the molecular formula C36H41N3O2 and a molecular weight of 547.74 g/mol. Its IUPAC name is N-[1-[(4-hydroxyphenyl)methyl]piperidin-4-yl]-4-pentyl-N-[(4-pyridin-3-ylphenyl)methyl]benzamide.
| Compound Name | N-[1-[(4-hydroxyphenyl)methyl]piperidin-4-yl]-4-pentyl-N-[(4-pyridin-3-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 10302679 |
| Molecular Formula | C36H41N3O2 |
| Molecular Weight | 547.74 g/mol |
| Exact Mass | 547.32 |
| IUPAC Name | N-[1-[(4-hydroxyphenyl)methyl]piperidin-4-yl]-4-pentyl-N-[(4-pyridin-3-ylphenyl)methyl]benzamide |
| SMILES | CCCCCc1ccc(C(=O)N(Cc2ccc(-c3cccnc3)cc2)C2CCN(Cc3ccc(O)cc3)CC2)cc1 |
| InChI | InChI=1S/C36H41N3O2/c1-2-3-4-6-28-8-16-32(17-9-28)36(41)39(27-30-10-14-31(15-11-30)33-7-5-22-37-25-33)34-20-23-38(24-21-34)26-29-12-18-35(40)19-13-29/h5,7-19,22,25,34,40H,2-4,6,20-21,23-24,26-27H2,1H3 |
| InChIKey | PJFJRTVPXPGIOV-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.74 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|