C19H16N2O2 — CID 134475022
N-[(3-hydroxyphenyl)methyl]-4-pyridin-4-ylbenzamide (PubChem CID 134475022) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is N-[(3-hydroxyphenyl)methyl]-4-pyridin-4-ylbenzamide.
| Compound Name | N-[(3-hydroxyphenyl)methyl]-4-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 134475022 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-[(3-hydroxyphenyl)methyl]-4-pyridin-4-ylbenzamide |
| SMILES | O=C(NCc1cccc(O)c1)c1ccc(-c2ccncc2)cc1 |
| InChI | InChI=1S/C19H16N2O2/c22-18-3-1-2-14(12-18)13-21-19(23)17-6-4-15(5-7-17)16-8-10-20-11-9-16/h1-12,22H,13H2,(H,21,23) |
| InChIKey | GRCSRBVHHUZIOU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |