C23H21N5O3 — CID 135404951
4-[4-[[(E)-3-(5-carbamimidoyl-2-hydroxyphenyl)prop-2-enyl]carbamoyl]phenyl]pyridine-2-carboxamide (PubChem CID 135404951) has the molecular formula C23H21N5O3 and a molecular weight of 415.45 g/mol. Its IUPAC name is 4-[4-[[(E)-3-(5-carbamimidoyl-2-hydroxyphenyl)prop-2-enyl]carbamoyl]phenyl]pyridine-2-carboxamide.
| Compound Name | 4-[4-[[(E)-3-(5-carbamimidoyl-2-hydroxyphenyl)prop-2-enyl]carbamoyl]phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 135404951 |
| Molecular Formula | C23H21N5O3 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 4-[4-[[(E)-3-(5-carbamimidoyl-2-hydroxyphenyl)prop-2-enyl]carbamoyl]phenyl]pyridine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(O)c(/C=C/CNC(=O)c2ccc(-c3ccnc(C(N)=O)c3)cc2)c1 |
| InChI | InChI=1S/C23H21N5O3/c24-21(25)18-7-8-20(29)17(12-18)2-1-10-28-23(31)15-5-3-14(4-6-15)16-9-11-27-19(13-16)22(26)30/h1-9,11-13,29H,10H2,(H3,24,25)(H2,26,30)(H,28,31)/b2-1+ |
| InChIKey | VSHBEBIVNLJTGI-OWOJBTEDSA-N |
| XLogP | 2.28 |
| TPSA | 155.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|