C12H16N2OS — CID 103027778
4-(1-methylpyrazol-4-yl)-1-thiophen-3-ylbutan-2-ol (PubChem CID 103027778) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is 4-(1-methylpyrazol-4-yl)-1-thiophen-3-ylbutan-2-ol.
| Compound Name | 4-(1-methylpyrazol-4-yl)-1-thiophen-3-ylbutan-2-ol |
|---|---|
| PubChem CID | 103027778 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 4-(1-methylpyrazol-4-yl)-1-thiophen-3-ylbutan-2-ol |
| SMILES | Cn1cc(CCC(O)Cc2ccsc2)cn1 |
| InChI | InChI=1S/C12H16N2OS/c1-14-8-11(7-13-14)2-3-12(15)6-10-4-5-16-9-10/h4-5,7-9,12,15H,2-3,6H2,1H3 |
| InChIKey | WVYGWLDSZHPGIN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |