C16H22N2O — CID 103027828
1-(2,5-dimethylphenyl)-4-(1-methylpyrazol-4-yl)butan-2-ol (PubChem CID 103027828) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-4-(1-methylpyrazol-4-yl)butan-2-ol.
| Compound Name | 1-(2,5-dimethylphenyl)-4-(1-methylpyrazol-4-yl)butan-2-ol |
|---|---|
| PubChem CID | 103027828 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-4-(1-methylpyrazol-4-yl)butan-2-ol |
| SMILES | Cc1ccc(C)c(CC(O)CCc2cnn(C)c2)c1 |
| InChI | InChI=1S/C16H22N2O/c1-12-4-5-13(2)15(8-12)9-16(19)7-6-14-10-17-18(3)11-14/h4-5,8,10-11,16,19H,6-7,9H2,1-3H3 |
| InChIKey | QODNNRSUNBAEPQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |