C12H22N4O3 — CID 103028689
2-[[5-(2-methoxypropan-2-yl)tetrazol-1-yl]methyl]-4-methylpentanoic acid (PubChem CID 103028689) has the molecular formula C12H22N4O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-[[5-(2-methoxypropan-2-yl)tetrazol-1-yl]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[5-(2-methoxypropan-2-yl)tetrazol-1-yl]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 103028689 |
| Molecular Formula | C12H22N4O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 2-[[5-(2-methoxypropan-2-yl)tetrazol-1-yl]methyl]-4-methylpentanoic acid |
| SMILES | COC(C)(C)c1nnnn1CC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C12H22N4O3/c1-8(2)6-9(10(17)18)7-16-11(13-14-15-16)12(3,4)19-5/h8-9H,6-7H2,1-5H3,(H,17,18) |
| InChIKey | NYWWFPWIRRLIDE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |