C12H15ClN4O2S — CID 80641921
2-[[5-(3-chlorothiophen-2-yl)tetrazol-1-yl]methyl]-4-methylpentanoic acid (PubChem CID 80641921) has the molecular formula C12H15ClN4O2S and a molecular weight of 314.80 g/mol. Its IUPAC name is 2-[[5-(3-chlorothiophen-2-yl)tetrazol-1-yl]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[5-(3-chlorothiophen-2-yl)tetrazol-1-yl]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 80641921 |
| Molecular Formula | C12H15ClN4O2S |
| Molecular Weight | 314.80 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-[[5-(3-chlorothiophen-2-yl)tetrazol-1-yl]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(Cn1nnnc1-c1sccc1Cl)C(=O)O |
| InChI | InChI=1S/C12H15ClN4O2S/c1-7(2)5-8(12(18)19)6-17-11(14-15-16-17)10-9(13)3-4-20-10/h3-4,7-8H,5-6H2,1-2H3,(H,18,19) |
| InChIKey | IOQIDEREZGGHRM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.80 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |