C10H11ClN4O2S — CID 103406894
3-[5-(3-chloro-4-methylthiophen-2-yl)tetrazol-1-yl]-2-methylpropanoic acid (PubChem CID 103406894) has the molecular formula C10H11ClN4O2S and a molecular weight of 286.74 g/mol. Its IUPAC name is 3-[5-(3-chloro-4-methylthiophen-2-yl)tetrazol-1-yl]-2-methylpropanoic acid.
| Compound Name | 3-[5-(3-chloro-4-methylthiophen-2-yl)tetrazol-1-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 103406894 |
| Molecular Formula | C10H11ClN4O2S |
| Molecular Weight | 286.74 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 3-[5-(3-chloro-4-methylthiophen-2-yl)tetrazol-1-yl]-2-methylpropanoic acid |
| SMILES | Cc1csc(-c2nnnn2CC(C)C(=O)O)c1Cl |
| InChI | InChI=1S/C10H11ClN4O2S/c1-5(10(16)17)3-15-9(12-13-14-15)8-7(11)6(2)4-18-8/h4-5H,3H2,1-2H3,(H,16,17) |
| InChIKey | UOPNIMHTEQVQIB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.74 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |