C12H12Cl2N4O2 — CID 80541340
4-[5-(2,4-dichlorophenyl)tetrazol-1-yl]-2-methylbutanoic acid (PubChem CID 80541340) has the molecular formula C12H12Cl2N4O2 and a molecular weight of 315.16 g/mol. Its IUPAC name is 4-[5-(2,4-dichlorophenyl)tetrazol-1-yl]-2-methylbutanoic acid.
| Compound Name | 4-[5-(2,4-dichlorophenyl)tetrazol-1-yl]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 80541340 |
| Molecular Formula | C12H12Cl2N4O2 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 4-[5-(2,4-dichlorophenyl)tetrazol-1-yl]-2-methylbutanoic acid |
| SMILES | CC(CCn1nnnc1-c1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C12H12Cl2N4O2/c1-7(12(19)20)4-5-18-11(15-16-17-18)9-3-2-8(13)6-10(9)14/h2-3,6-7H,4-5H2,1H3,(H,19,20) |
| InChIKey | FRYWEXJLJWBTLF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |