C14H18N4O2 — CID 80541663
4-[5-(2,4-dimethylphenyl)tetrazol-1-yl]-2-methylbutanoic acid (PubChem CID 80541663) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-[5-(2,4-dimethylphenyl)tetrazol-1-yl]-2-methylbutanoic acid.
| Compound Name | 4-[5-(2,4-dimethylphenyl)tetrazol-1-yl]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 80541663 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 4-[5-(2,4-dimethylphenyl)tetrazol-1-yl]-2-methylbutanoic acid |
| SMILES | Cc1ccc(-c2nnnn2CCC(C)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C14H18N4O2/c1-9-4-5-12(11(3)8-9)13-15-16-17-18(13)7-6-10(2)14(19)20/h4-5,8,10H,6-7H2,1-3H3,(H,19,20) |
| InChIKey | DBOOHKOIAUHQFA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |