C18H27N3 — CID 103030099
5-methyl-1-(1-methylpyrazol-4-yl)-4-phenylheptan-3-amine (PubChem CID 103030099) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is 5-methyl-1-(1-methylpyrazol-4-yl)-4-phenylheptan-3-amine.
| Compound Name | 5-methyl-1-(1-methylpyrazol-4-yl)-4-phenylheptan-3-amine |
|---|---|
| PubChem CID | 103030099 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 5-methyl-1-(1-methylpyrazol-4-yl)-4-phenylheptan-3-amine |
| SMILES | CCC(C)C(c1ccccc1)C(N)CCc1cnn(C)c1 |
| InChI | InChI=1S/C18H27N3/c1-4-14(2)18(16-8-6-5-7-9-16)17(19)11-10-15-12-20-21(3)13-15/h5-9,12-14,17-18H,4,10-11,19H2,1-3H3 |
| InChIKey | RTTITLGEHXAIHI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |