C14H26F3NO — CID 103031991
4-methoxy-4-methyl-1-[3-(trifluoromethyl)cyclohexyl]pentan-1-amine (PubChem CID 103031991) has the molecular formula C14H26F3NO and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-methoxy-4-methyl-1-[3-(trifluoromethyl)cyclohexyl]pentan-1-amine.
| Compound Name | 4-methoxy-4-methyl-1-[3-(trifluoromethyl)cyclohexyl]pentan-1-amine |
|---|---|
| PubChem CID | 103031991 |
| Molecular Formula | C14H26F3NO |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 4-methoxy-4-methyl-1-[3-(trifluoromethyl)cyclohexyl]pentan-1-amine |
| SMILES | COC(C)(C)CCC(N)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C14H26F3NO/c1-13(2,19-3)8-7-12(18)10-5-4-6-11(9-10)14(15,16)17/h10-12H,4-9,18H2,1-3H3 |
| InChIKey | WFGMXIYRLKGCFY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |