C14H27F2NO — CID 54123882
1-cyclohexyl-4,4-difluoro-5-propan-2-yloxypentan-2-amine (PubChem CID 54123882) has the molecular formula C14H27F2NO and a molecular weight of 263.37 g/mol. Its IUPAC name is 1-cyclohexyl-4,4-difluoro-5-propan-2-yloxypentan-2-amine.
| Compound Name | 1-cyclohexyl-4,4-difluoro-5-propan-2-yloxypentan-2-amine |
|---|---|
| PubChem CID | 54123882 |
| Molecular Formula | C14H27F2NO |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | 1-cyclohexyl-4,4-difluoro-5-propan-2-yloxypentan-2-amine |
| SMILES | CC(C)OCC(F)(F)CC(N)CC1CCCCC1 |
| InChI | InChI=1S/C14H27F2NO/c1-11(2)18-10-14(15,16)9-13(17)8-12-6-4-3-5-7-12/h11-13H,3-10,17H2,1-2H3 |
| InChIKey | NPPQPJASYOCXKD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |