C14H27F2NO2 — CID 14629908
(2S,3R,5R)-2-amino-1-cyclohexyl-4,4-difluoro-6-methylheptane-3,5-diol (PubChem CID 14629908) has the molecular formula C14H27F2NO2 and a molecular weight of 279.37 g/mol. Its IUPAC name is (2S,3R,5R)-2-amino-1-cyclohexyl-4,4-difluoro-6-methylheptane-3,5-diol.
| Compound Name | (2S,3R,5R)-2-amino-1-cyclohexyl-4,4-difluoro-6-methylheptane-3,5-diol |
|---|---|
| PubChem CID | 14629908 |
| Molecular Formula | C14H27F2NO2 |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | (2S,3R,5R)-2-amino-1-cyclohexyl-4,4-difluoro-6-methylheptane-3,5-diol |
| SMILES | CC(C)[C@@H](O)C(F)(F)[C@H](O)[C@@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C14H27F2NO2/c1-9(2)12(18)14(15,16)13(19)11(17)8-10-6-4-3-5-7-10/h9-13,18-19H,3-8,17H2,1-2H3/t11-,12+,13+/m0/s1 |
| InChIKey | JVADNGBUHVXBCV-YNEHKIRRSA-N |
| XLogP | 2.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |