C13H25F2NO — CID 103032005
1-(4,4-difluorocyclohexyl)-4-methoxy-4-methylpentan-1-amine (PubChem CID 103032005) has the molecular formula C13H25F2NO and a molecular weight of 249.34 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-4-methoxy-4-methylpentan-1-amine.
| Compound Name | 1-(4,4-difluorocyclohexyl)-4-methoxy-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 103032005 |
| Molecular Formula | C13H25F2NO |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-4-methoxy-4-methylpentan-1-amine |
| SMILES | COC(C)(C)CCC(N)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H25F2NO/c1-12(2,17-3)7-6-11(16)10-4-8-13(14,15)9-5-10/h10-11H,4-9,16H2,1-3H3 |
| InChIKey | QJKWPZVQIYBDOY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |