C13H27NO3 — CID 103034658
4-[(3-methoxy-3-methylbutyl)-propan-2-ylamino]butanoic acid (PubChem CID 103034658) has the molecular formula C13H27NO3 and a molecular weight of 245.36 g/mol. Its IUPAC name is 4-[(3-methoxy-3-methylbutyl)-propan-2-ylamino]butanoic acid.
| Compound Name | 4-[(3-methoxy-3-methylbutyl)-propan-2-ylamino]butanoic acid |
|---|---|
| PubChem CID | 103034658 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | 4-[(3-methoxy-3-methylbutyl)-propan-2-ylamino]butanoic acid |
| SMILES | COC(C)(C)CCN(CCCC(=O)O)C(C)C |
| InChI | InChI=1S/C13H27NO3/c1-11(2)14(9-6-7-12(15)16)10-8-13(3,4)17-5/h11H,6-10H2,1-5H3,(H,15,16) |
| InChIKey | TVSDEVKRMDBXGV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |