C16H24O4 — CID 103034779
5-methoxy-2-[(2-methoxyphenyl)methyl]-5-methylhexanoic acid (PubChem CID 103034779) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 5-methoxy-2-[(2-methoxyphenyl)methyl]-5-methylhexanoic acid.
| Compound Name | 5-methoxy-2-[(2-methoxyphenyl)methyl]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 103034779 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 5-methoxy-2-[(2-methoxyphenyl)methyl]-5-methylhexanoic acid |
| SMILES | COc1ccccc1CC(CCC(C)(C)OC)C(=O)O |
| InChI | InChI=1S/C16H24O4/c1-16(2,20-4)10-9-13(15(17)18)11-12-7-5-6-8-14(12)19-3/h5-8,13H,9-11H2,1-4H3,(H,17,18) |
| InChIKey | UMQNVKXXNNACBG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |