C14H31NO2 — CID 103036101
3-ethyl-3,7-dimethoxy-N,7-dimethyloctan-4-amine (PubChem CID 103036101) has the molecular formula C14H31NO2 and a molecular weight of 245.41 g/mol. Its IUPAC name is 3-ethyl-3,7-dimethoxy-N,7-dimethyloctan-4-amine.
| Compound Name | 3-ethyl-3,7-dimethoxy-N,7-dimethyloctan-4-amine |
|---|---|
| PubChem CID | 103036101 |
| Molecular Formula | C14H31NO2 |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.24 |
| IUPAC Name | 3-ethyl-3,7-dimethoxy-N,7-dimethyloctan-4-amine |
| SMILES | CCC(CC)(OC)C(CCC(C)(C)OC)NC |
| InChI | InChI=1S/C14H31NO2/c1-8-14(9-2,17-7)12(15-5)10-11-13(3,4)16-6/h12,15H,8-11H2,1-7H3 |
| InChIKey | NUNFIQNCVYMDIR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |