C13H29NO2 — CID 103031280
2,7-dimethoxy-N,2,7-trimethyloctan-4-amine (PubChem CID 103031280) has the molecular formula C13H29NO2 and a molecular weight of 231.38 g/mol. Its IUPAC name is 2,7-dimethoxy-N,2,7-trimethyloctan-4-amine.
| Compound Name | 2,7-dimethoxy-N,2,7-trimethyloctan-4-amine |
|---|---|
| PubChem CID | 103031280 |
| Molecular Formula | C13H29NO2 |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.22 |
| IUPAC Name | 2,7-dimethoxy-N,2,7-trimethyloctan-4-amine |
| SMILES | CNC(CCC(C)(C)OC)CC(C)(C)OC |
| InChI | InChI=1S/C13H29NO2/c1-12(2,15-6)9-8-11(14-5)10-13(3,4)16-7/h11,14H,8-10H2,1-7H3 |
| InChIKey | SJUORMODUSPKBP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |