C14H31NO — CID 103025252
N-ethyl-2-methoxy-2,7,7-trimethyloctan-4-amine (PubChem CID 103025252) has the molecular formula C14H31NO and a molecular weight of 229.41 g/mol. Its IUPAC name is N-ethyl-2-methoxy-2,7,7-trimethyloctan-4-amine.
| Compound Name | N-ethyl-2-methoxy-2,7,7-trimethyloctan-4-amine |
|---|---|
| PubChem CID | 103025252 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | N-ethyl-2-methoxy-2,7,7-trimethyloctan-4-amine |
| SMILES | CCNC(CCC(C)(C)C)CC(C)(C)OC |
| InChI | InChI=1S/C14H31NO/c1-8-15-12(9-10-13(2,3)4)11-14(5,6)16-7/h12,15H,8-11H2,1-7H3 |
| InChIKey | SVKJSHPCPRZKOL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |