C12H24F3N — CID 79954629
N-ethyl-1,1,1-trifluoro-7,7-dimethyloctan-4-amine (PubChem CID 79954629) has the molecular formula C12H24F3N and a molecular weight of 239.32 g/mol. Its IUPAC name is N-ethyl-1,1,1-trifluoro-7,7-dimethyloctan-4-amine.
| Compound Name | N-ethyl-1,1,1-trifluoro-7,7-dimethyloctan-4-amine |
|---|---|
| PubChem CID | 79954629 |
| Molecular Formula | C12H24F3N |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | N-ethyl-1,1,1-trifluoro-7,7-dimethyloctan-4-amine |
| SMILES | CCNC(CCC(C)(C)C)CCC(F)(F)F |
| InChI | InChI=1S/C12H24F3N/c1-5-16-10(6-8-11(2,3)4)7-9-12(13,14)15/h10,16H,5-9H2,1-4H3 |
| InChIKey | VQORNVPJLPNWTB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |