C14H27NO — CID 103037570
3-(3-methoxy-3-methylbutyl)-5,5-dimethylcyclohex-2-en-1-amine (PubChem CID 103037570) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is 3-(3-methoxy-3-methylbutyl)-5,5-dimethylcyclohex-2-en-1-amine.
| Compound Name | 3-(3-methoxy-3-methylbutyl)-5,5-dimethylcyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 103037570 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 3-(3-methoxy-3-methylbutyl)-5,5-dimethylcyclohex-2-en-1-amine |
| SMILES | COC(C)(C)CCC1=CC(N)CC(C)(C)C1 |
| InChI | InChI=1S/C14H27NO/c1-13(2)9-11(8-12(15)10-13)6-7-14(3,4)16-5/h8,12H,6-7,9-10,15H2,1-5H3 |
| InChIKey | UXQKTBSWSZSVRC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|