C13H16ClFO2 — CID 103038739
2-[(3-chloro-4-fluorophenyl)methyl]-3,3-dimethylbutanoic acid (PubChem CID 103038739) has the molecular formula C13H16ClFO2 and a molecular weight of 258.72 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)methyl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)methyl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 103038739 |
| Molecular Formula | C13H16ClFO2 |
| Molecular Weight | 258.72 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)methyl]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(Cc1ccc(F)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C13H16ClFO2/c1-13(2,3)9(12(16)17)6-8-4-5-11(15)10(14)7-8/h4-5,7,9H,6H2,1-3H3,(H,16,17) |
| InChIKey | MYGBLQUOJNWHBD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.72 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |