C10H7ClF4O — CID 103039327
1-(3-chloro-4-fluorophenyl)-4,4,4-trifluorobutan-2-one (PubChem CID 103039327) has the molecular formula C10H7ClF4O and a molecular weight of 254.61 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-4,4,4-trifluorobutan-2-one.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-4,4,4-trifluorobutan-2-one |
|---|---|
| PubChem CID | 103039327 |
| Molecular Formula | C10H7ClF4O |
| Molecular Weight | 254.61 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-4,4,4-trifluorobutan-2-one |
| SMILES | O=C(Cc1ccc(F)c(Cl)c1)CC(F)(F)F |
| InChI | InChI=1S/C10H7ClF4O/c11-8-4-6(1-2-9(8)12)3-7(16)5-10(13,14)15/h1-2,4H,3,5H2 |
| InChIKey | MJUSEIOCXIDLLD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.61 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |