C11H9ClF4O — CID 159945901
5-(3-chloro-4-fluorophenyl)-1,1,1-trifluoropentan-2-one (PubChem CID 159945901) has the molecular formula C11H9ClF4O and a molecular weight of 268.64 g/mol. Its IUPAC name is 5-(3-chloro-4-fluorophenyl)-1,1,1-trifluoropentan-2-one.
| Compound Name | 5-(3-chloro-4-fluorophenyl)-1,1,1-trifluoropentan-2-one |
|---|---|
| PubChem CID | 159945901 |
| Molecular Formula | C11H9ClF4O |
| Molecular Weight | 268.64 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 5-(3-chloro-4-fluorophenyl)-1,1,1-trifluoropentan-2-one |
| SMILES | O=C(CCCc1ccc(F)c(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C11H9ClF4O/c12-8-6-7(4-5-9(8)13)2-1-3-10(17)11(14,15)16/h4-6H,1-3H2 |
| InChIKey | OBMDITLLIXYWBX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.64 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |