C15H19ClFN3 — CID 103040107
N-[2-(3-chloro-4-fluorophenyl)-1-(1-methylpyrazol-3-yl)ethyl]propan-1-amine (PubChem CID 103040107) has the molecular formula C15H19ClFN3 and a molecular weight of 295.79 g/mol. Its IUPAC name is N-[2-(3-chloro-4-fluorophenyl)-1-(1-methylpyrazol-3-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(3-chloro-4-fluorophenyl)-1-(1-methylpyrazol-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 103040107 |
| Molecular Formula | C15H19ClFN3 |
| Molecular Weight | 295.79 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-[2-(3-chloro-4-fluorophenyl)-1-(1-methylpyrazol-3-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(F)c(Cl)c1)c1ccn(C)n1 |
| InChI | InChI=1S/C15H19ClFN3/c1-3-7-18-15(14-6-8-20(2)19-14)10-11-4-5-13(17)12(16)9-11/h4-6,8-9,15,18H,3,7,10H2,1-2H3 |
| InChIKey | NKJNYZIEXOELSX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.79 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |