C17H23ClFN — CID 103040435
1-(2-bicyclo[2.2.1]heptanyl)-2-(3-chloro-4-fluorophenyl)-N-ethylethanamine (PubChem CID 103040435) has the molecular formula C17H23ClFN and a molecular weight of 295.83 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-2-(3-chloro-4-fluorophenyl)-N-ethylethanamine.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-2-(3-chloro-4-fluorophenyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 103040435 |
| Molecular Formula | C17H23ClFN |
| Molecular Weight | 295.83 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-2-(3-chloro-4-fluorophenyl)-N-ethylethanamine |
| SMILES | CCNC(Cc1ccc(F)c(Cl)c1)C1CC2CCC1C2 |
| InChI | InChI=1S/C17H23ClFN/c1-2-20-17(14-8-11-3-5-13(14)7-11)10-12-4-6-16(19)15(18)9-12/h4,6,9,11,13-14,17,20H,2-3,5,7-8,10H2,1H3 |
| InChIKey | QZDWCLMCHHFIFF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.83 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |