C10H9ClFN3O2S — CID 103042428
1-[(3-chloro-4-fluorophenyl)methyl]imidazole-4-sulfonamide (PubChem CID 103042428) has the molecular formula C10H9ClFN3O2S and a molecular weight of 289.72 g/mol. Its IUPAC name is 1-[(3-chloro-4-fluorophenyl)methyl]imidazole-4-sulfonamide.
| Compound Name | 1-[(3-chloro-4-fluorophenyl)methyl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 103042428 |
| Molecular Formula | C10H9ClFN3O2S |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 1-[(3-chloro-4-fluorophenyl)methyl]imidazole-4-sulfonamide |
| SMILES | NS(=O)(=O)c1cn(Cc2ccc(F)c(Cl)c2)cn1 |
| InChI | InChI=1S/C10H9ClFN3O2S/c11-8-3-7(1-2-9(8)12)4-15-5-10(14-6-15)18(13,16)17/h1-3,5-6H,4H2,(H2,13,16,17) |
| InChIKey | QKQQXTGDCNQJAD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |