C16H16BrClFN — CID 103043118
1-(3-bromo-2-methylphenyl)-2-(3-chloro-4-fluorophenyl)-N-methylethanamine (PubChem CID 103043118) has the molecular formula C16H16BrClFN and a molecular weight of 356.67 g/mol. Its IUPAC name is 1-(3-bromo-2-methylphenyl)-2-(3-chloro-4-fluorophenyl)-N-methylethanamine.
| Compound Name | 1-(3-bromo-2-methylphenyl)-2-(3-chloro-4-fluorophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 103043118 |
| Molecular Formula | C16H16BrClFN |
| Molecular Weight | 356.67 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | 1-(3-bromo-2-methylphenyl)-2-(3-chloro-4-fluorophenyl)-N-methylethanamine |
| SMILES | CNC(Cc1ccc(F)c(Cl)c1)c1cccc(Br)c1C |
| InChI | InChI=1S/C16H16BrClFN/c1-10-12(4-3-5-13(10)17)16(20-2)9-11-6-7-15(19)14(18)8-11/h3-8,16,20H,9H2,1-2H3 |
| InChIKey | PYEYOMCKZHZOSE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.67 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |