C15H16BrClFNS — CID 103043163
1-(5-bromo-4-methylthiophen-2-yl)-2-(3-chloro-4-fluorophenyl)-N-ethylethanamine (PubChem CID 103043163) has the molecular formula C15H16BrClFNS and a molecular weight of 376.72 g/mol. Its IUPAC name is 1-(5-bromo-4-methylthiophen-2-yl)-2-(3-chloro-4-fluorophenyl)-N-ethylethanamine.
| Compound Name | 1-(5-bromo-4-methylthiophen-2-yl)-2-(3-chloro-4-fluorophenyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 103043163 |
| Molecular Formula | C15H16BrClFNS |
| Molecular Weight | 376.72 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | 1-(5-bromo-4-methylthiophen-2-yl)-2-(3-chloro-4-fluorophenyl)-N-ethylethanamine |
| SMILES | CCNC(Cc1ccc(F)c(Cl)c1)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C15H16BrClFNS/c1-3-19-13(14-6-9(2)15(16)20-14)8-10-4-5-12(18)11(17)7-10/h4-7,13,19H,3,8H2,1-2H3 |
| InChIKey | XPROQKXMDVZZCV-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.72 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |