C16H18BrClFNS — CID 103053247
N-[1-(5-bromo-4-methylthiophen-2-yl)-2-(5-chloro-2-fluorophenyl)ethyl]propan-1-amine (PubChem CID 103053247) has the molecular formula C16H18BrClFNS and a molecular weight of 390.75 g/mol. Its IUPAC name is N-[1-(5-bromo-4-methylthiophen-2-yl)-2-(5-chloro-2-fluorophenyl)ethyl]propan-1-amine.
| Compound Name | N-[1-(5-bromo-4-methylthiophen-2-yl)-2-(5-chloro-2-fluorophenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 103053247 |
| Molecular Formula | C16H18BrClFNS |
| Molecular Weight | 390.75 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | N-[1-(5-bromo-4-methylthiophen-2-yl)-2-(5-chloro-2-fluorophenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1cc(Cl)ccc1F)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C16H18BrClFNS/c1-3-6-20-14(15-7-10(2)16(17)21-15)9-11-8-12(18)4-5-13(11)19/h4-5,7-8,14,20H,3,6,9H2,1-2H3 |
| InChIKey | MEWLLQFFXADMDB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.75 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |