C17H21BrFNS — CID 105050942
N-[1-(5-bromo-4-methylthiophen-2-yl)-2-(4-fluoro-2-methylphenyl)ethyl]propan-1-amine (PubChem CID 105050942) has the molecular formula C17H21BrFNS and a molecular weight of 370.33 g/mol. Its IUPAC name is N-[1-(5-bromo-4-methylthiophen-2-yl)-2-(4-fluoro-2-methylphenyl)ethyl]propan-1-amine.
| Compound Name | N-[1-(5-bromo-4-methylthiophen-2-yl)-2-(4-fluoro-2-methylphenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 105050942 |
| Molecular Formula | C17H21BrFNS |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | N-[1-(5-bromo-4-methylthiophen-2-yl)-2-(4-fluoro-2-methylphenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(F)cc1C)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C17H21BrFNS/c1-4-7-20-15(16-9-12(3)17(18)21-16)10-13-5-6-14(19)8-11(13)2/h5-6,8-9,15,20H,4,7,10H2,1-3H3 |
| InChIKey | JVNMJVCQYONXMG-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |