C14H16ClFN2OS — CID 103043552
1-(4-tert-butylthiadiazol-5-yl)-2-(3-chloro-4-fluorophenyl)ethanol (PubChem CID 103043552) has the molecular formula C14H16ClFN2OS and a molecular weight of 314.81 g/mol. Its IUPAC name is 1-(4-tert-butylthiadiazol-5-yl)-2-(3-chloro-4-fluorophenyl)ethanol.
| Compound Name | 1-(4-tert-butylthiadiazol-5-yl)-2-(3-chloro-4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 103043552 |
| Molecular Formula | C14H16ClFN2OS |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 1-(4-tert-butylthiadiazol-5-yl)-2-(3-chloro-4-fluorophenyl)ethanol |
| SMILES | CC(C)(C)c1nnsc1C(O)Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H16ClFN2OS/c1-14(2,3)13-12(20-18-17-13)11(19)7-8-4-5-10(16)9(15)6-8/h4-6,11,19H,7H2,1-3H3 |
| InChIKey | KFXIUYZTELQCDL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |