C15H9Cl2NO2S — CID 103045237
1-(2,5-dichlorothiophen-3-yl)-2-quinolin-5-yloxyethanone (PubChem CID 103045237) has the molecular formula C15H9Cl2NO2S and a molecular weight of 338.22 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-2-quinolin-5-yloxyethanone.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-2-quinolin-5-yloxyethanone |
|---|---|
| PubChem CID | 103045237 |
| Molecular Formula | C15H9Cl2NO2S |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-2-quinolin-5-yloxyethanone |
| SMILES | O=C(COc1cccc2ncccc12)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C15H9Cl2NO2S/c16-14-7-10(15(17)21-14)12(19)8-20-13-5-1-4-11-9(13)3-2-6-18-11/h1-7H,8H2 |
| InChIKey | QBBJTUALRXWQIF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |