C15H14N4O — CID 103046138
N,4-dimethyl-6-quinolin-5-yloxypyrimidin-2-amine (PubChem CID 103046138) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is N,4-dimethyl-6-quinolin-5-yloxypyrimidin-2-amine.
| Compound Name | N,4-dimethyl-6-quinolin-5-yloxypyrimidin-2-amine |
|---|---|
| PubChem CID | 103046138 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | N,4-dimethyl-6-quinolin-5-yloxypyrimidin-2-amine |
| SMILES | CNc1nc(C)cc(Oc2cccc3ncccc23)n1 |
| InChI | InChI=1S/C15H14N4O/c1-10-9-14(19-15(16-2)18-10)20-13-7-3-6-12-11(13)5-4-8-17-12/h3-9H,1-2H3,(H,16,18,19) |
| InChIKey | ZJFIJOXJXJUENI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |